ChemNet > CAS > 39827-11-7 Benzo[b]thiophene-2-carbonyl chloride
39827-11-7 Benzo[b]thiophene-2-carbonyl chloride
상품명칭 |
Benzo[b]thiophene-2-carbonyl chloride |
별명 |
Thianaphthene-2-carbonyl chloride; 1-benzothiophene-2-carbonyl chloride |
분자식 |
C9H5ClOS |
분자량 |
196.6534 |
InChI |
InChI=1/C9H5ClOS/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H |
cas번호 |
39827-11-7 |
분자 구조 |
|
밀도 |
1.41g/cm3 |
녹는 점 |
85℃ |
비등점 |
309.5°C at 760 mmHg |
굴절 지수 |
1.68 |
인화점 |
141°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|